89-87-2 4-Nitro-m-xylene

product Name 4-Nitro-m-xylene Synonyms 1,3-Dimethyl-4-nitrobenzene; 2,4-Dimethylnitrobenzene; 4-Nitro-1,3-Dimethylbenzene; Nitromxylene; 2,4-Dimethy Nitrobenzene; 2,4-dimethyl-1-nitrobenzene Molecular Formula C8H9NO2 Molecular Weight 151.1626 InChI InChI=1/C8H9NO2/c1-6-3-4-8(9(10)11)7(2)5-6/h3-5H,1-2H3 CAS Registry Number 89-87-2 EINECS 201-947-4 Molecular Structure Density 1.129g/cm3 Melting point 5-7°C Boiling point 244.1°C at 760 mmHg Refractive index 1.547 Flash point 107.2°C Water solubility 133 mg/L (20°C) Vapour Pressur 0.0483mmHg at 25°C Hazard Symbols  Xn:Harmful; Risk Codes R20/21/22:; Safety Description S36/37:;

Why do we deserve your choice

1. We Orchid Chemical Supplies Ltd  has been manufacturing, marketing and distributing fine chemicals, active pharmaceutical ingredients and dietary supplements and additives to finished dosage manufacturers for more than 10 years.

2.We provides knowledge and understanding of all the necessary requirements with the expert advise from our experienced regulatory consultants.

Pls write email for quotation,specification, delivery time. etc. Thanks.